C30H29N5O — CID 58011007
1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[4-(pyridin-3-ylmethyl)naphthalen-1-yl]urea (PubChem CID 58011007) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[4-(pyridin-3-ylmethyl)naphthalen-1-yl]urea.
| Compound Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[4-(pyridin-3-ylmethyl)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 58011007 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[4-(pyridin-3-ylmethyl)naphthalen-1-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Cc3cccnc3)c3ccccc23)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C30H29N5O/c1-30(2,3)27-19-28(35(34-27)23-11-5-4-6-12-23)33-29(36)32-26-16-15-22(18-21-10-9-17-31-20-21)24-13-7-8-14-25(24)26/h4-17,19-20H,18H2,1-3H3,(H2,32,33,36) |
| InChIKey | PELCLVQIKVAZKX-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |