C26H26N4O4 — CID 58842920
2-[3-[3-tert-butyl-5-(naphthalen-1-ylcarbamoylamino)pyrazol-1-yl]phenoxy]acetic acid (PubChem CID 58842920) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[3-[3-tert-butyl-5-(naphthalen-1-ylcarbamoylamino)pyrazol-1-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-tert-butyl-5-(naphthalen-1-ylcarbamoylamino)pyrazol-1-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 58842920 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[3-[3-tert-butyl-5-(naphthalen-1-ylcarbamoylamino)pyrazol-1-yl]phenoxy]acetic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc3ccccc23)n(-c2cccc(OCC(=O)O)c2)n1 |
| InChI | InChI=1S/C26H26N4O4/c1-26(2,3)22-15-23(30(29-22)18-10-7-11-19(14-18)34-16-24(31)32)28-25(33)27-21-13-6-9-17-8-4-5-12-20(17)21/h4-15H,16H2,1-3H3,(H,31,32)(H2,27,28,33) |
| InChIKey | CSTYCWURLDZAHE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |