C22H17F3N4O2 — CID 58011122
1-[1-(3-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-3-naphthalen-1-ylurea (PubChem CID 58011122) has the molecular formula C22H17F3N4O2 and a molecular weight of 426.40 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[1-(3-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 58011122 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-3-naphthalen-1-ylurea |
| SMILES | COc1cccc(-n2nc(C(F)(F)F)cc2NC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H17F3N4O2/c1-31-16-9-5-8-15(12-16)29-20(13-19(28-29)22(23,24)25)27-21(30)26-18-11-4-7-14-6-2-3-10-17(14)18/h2-13H,1H3,(H2,26,27,30) |
| InChIKey | JUMKDBBNHWKVNZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |