C28H26N6O4 — CID 18449843
1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-naphthalen-1-ylurea (PubChem CID 18449843) has the molecular formula C28H26N6O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 18449843 |
| Molecular Formula | C28H26N6O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-naphthalen-1-ylurea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc3ccccc23)n(-c2cccc(CN3C(=O)NC(=O)C3=O)c2)n1 |
| InChI | InChI=1S/C28H26N6O4/c1-28(2,3)22-15-23(30-26(37)29-21-13-7-10-18-9-4-5-12-20(18)21)34(32-22)19-11-6-8-17(14-19)16-33-25(36)24(35)31-27(33)38/h4-15H,16H2,1-3H3,(H2,29,30,37)(H,31,35,38) |
| InChIKey | DSQUWMFQCYTRQY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|