C24H22Cl2N6O4 — CID 11720684
1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea (PubChem CID 11720684) has the molecular formula C24H22Cl2N6O4 and a molecular weight of 529.38 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 11720684 |
| Molecular Formula | C24H22Cl2N6O4 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1-[3-tert-butyl-1-[3-[(2,4,5-trioxoimidazolidin-1-yl)methyl]phenyl]pyrazol-5-yl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc(Cl)c2Cl)n(-c2cccc(CN3C(=O)NC(=O)C3=O)c2)n1 |
| InChI | InChI=1S/C24H22Cl2N6O4/c1-24(2,3)17-11-18(28-22(35)27-16-9-5-8-15(25)19(16)26)32(30-17)14-7-4-6-13(10-14)12-31-21(34)20(33)29-23(31)36/h4-11H,12H2,1-3H3,(H2,27,28,35)(H,29,33,36) |
| InChIKey | QZZSUJCJODGEQB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|