C33H34N4O4 — CID 155664578
3-[4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]naphthalen-1-yl]propyl furan-2-carboxylate (PubChem CID 155664578) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is 3-[4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]naphthalen-1-yl]propyl furan-2-carboxylate.
| Compound Name | 3-[4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]naphthalen-1-yl]propyl furan-2-carboxylate |
|---|---|
| PubChem CID | 155664578 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 3-[4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]naphthalen-1-yl]propyl furan-2-carboxylate |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CCCOC(=O)c3ccco3)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H34N4O4/c1-22-13-16-24(17-14-22)37-30(21-29(36-37)33(2,3)4)35-32(39)34-27-18-15-23(25-10-5-6-11-26(25)27)9-7-20-41-31(38)28-12-8-19-40-28/h5-6,8,10-19,21H,7,9,20H2,1-4H3,(H2,34,35,39) |
| InChIKey | QTLXUAUINZEGAE-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|