C27H33N3O3S — CID 22628059
[4-[tert-butyl(ethyl)amino]phenyl]-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 22628059) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is [4-[tert-butyl(ethyl)amino]phenyl]-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [4-[tert-butyl(ethyl)amino]phenyl]-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 22628059 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [4-[tert-butyl(ethyl)amino]phenyl]-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCN(c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H33N3O3S/c1-5-30(27(2,3)4)24-13-10-22(11-14-24)26(31)28-16-18-29(19-17-28)34(32,33)25-15-12-21-8-6-7-9-23(21)20-25/h6-15,20H,5,16-19H2,1-4H3 |
| InChIKey | TWGNHYSGZDOBTN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |