C28H32Cl2N4O3S — CID 22628091
[4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-[4-(1-ethanimidoylpiperidin-4-yl)phenyl]methanone;hydrochloride (PubChem CID 22628091) has the molecular formula C28H32Cl2N4O3S and a molecular weight of 575.56 g/mol. Its IUPAC name is [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-[4-(1-ethanimidoylpiperidin-4-yl)phenyl]methanone;hydrochloride.
| Compound Name | [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-[4-(1-ethanimidoylpiperidin-4-yl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 22628091 |
| Molecular Formula | C28H32Cl2N4O3S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-[4-(1-ethanimidoylpiperidin-4-yl)phenyl]methanone;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)N1CCC(c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc5cc(Cl)ccc5c4)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H31ClN4O3S.ClH/c1-20(30)31-12-10-22(11-13-31)21-2-4-23(5-3-21)28(34)32-14-16-33(17-15-32)37(35,36)27-9-7-24-18-26(29)8-6-25(24)19-27;/h2-9,18-19,22,30H,10-17H2,1H3;1H/b30-20+; |
| InChIKey | XEDOXZCIEHTJSO-BNCTYUPTSA-N |
| XLogP | 5.24 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|