C36H37N3O14S3 — CID 22629000
5-[[4-(2-methoxyethoxy)benzoyl]amino]-2-[(E)-2-[4-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 22629000) has the molecular formula C36H37N3O14S3 and a molecular weight of 831.90 g/mol. Its IUPAC name is 5-[[4-(2-methoxyethoxy)benzoyl]amino]-2-[(E)-2-[4-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[[4-(2-methoxyethoxy)benzoyl]amino]-2-[(E)-2-[4-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22629000 |
| Molecular Formula | C36H37N3O14S3 |
| Molecular Weight | 831.90 g/mol |
| Exact Mass | 831.14 |
| IUPAC Name | 5-[[4-(2-methoxyethoxy)benzoyl]amino]-2-[(E)-2-[4-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(/C=C/c3ccc(NC(=O)c4ccc(OC)c(S(=O)(=O)N5CCOCC5)c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C36H37N3O14S3/c1-50-19-20-53-30-12-7-26(8-13-30)35(40)37-28-10-5-24(32(22-28)55(44,45)46)3-4-25-6-11-29(23-33(25)56(47,48)49)38-36(41)27-9-14-31(51-2)34(21-27)54(42,43)39-15-17-52-18-16-39/h3-14,21-23H,15-20H2,1-2H3,(H,37,40)(H,38,41)(H,44,45,46)(H,47,48,49)/b4-3+ |
| InChIKey | UQXCRKDXWLYFEZ-ONEGZZNKSA-N |
| XLogP | 3.91 |
| TPSA | 241.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|