C15H7ClFN5O2 — CID 22629123
2-(3-chloro-4-fluoroanilino)-6-nitro-1,8-naphthyridine-3-carbonitrile (PubChem CID 22629123) has the molecular formula C15H7ClFN5O2 and a molecular weight of 343.71 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)-6-nitro-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 2-(3-chloro-4-fluoroanilino)-6-nitro-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22629123 |
| Molecular Formula | C15H7ClFN5O2 |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)-6-nitro-1,8-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cc2cc([N+](=O)[O-])cnc2nc1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H7ClFN5O2/c16-12-5-10(1-2-13(12)17)20-15-9(6-18)3-8-4-11(22(23)24)7-19-14(8)21-15/h1-5,7H,(H,19,20,21) |
| InChIKey | BHRLLLRJKFSRBI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|