C30H26ClF3N4O4 — CID 22632603
4-(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carboximidoyl)phenyl]methyl]-3,5-dihydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 22632603) has the molecular formula C30H26ClF3N4O4 and a molecular weight of 599.01 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carboximidoyl)phenyl]methyl]-3,5-dihydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carboximidoyl)phenyl]methyl]-3,5-dihydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22632603 |
| Molecular Formula | C30H26ClF3N4O4 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 4-(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carboximidoyl)phenyl]methyl]-3,5-dihydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(/c1ccc(CN2C(=O)CN(C(=O)c3ccc(Cl)cc3)Cc3ccccc32)cc1)N1CC=CC1 |
| InChI | InChI=1S/C28H25ClN4O2.C2HF3O2/c29-24-13-11-22(12-14-24)28(35)32-18-23-5-1-2-6-25(23)33(26(34)19-32)17-20-7-9-21(10-8-20)27(30)31-15-3-4-16-31;3-2(4,5)1(6)7/h1-14,30H,15-19H2;(H,6,7)/b30-27-; |
| InChIKey | CIDCHCMRWIZVSK-NHUYCKTKSA-N |
| XLogP | 5.36 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|