C22H26N4O2S — CID 22634424
2-(butylcarbamoylamino)-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 22634424) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(butylcarbamoylamino)-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(butylcarbamoylamino)-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22634424 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(butylcarbamoylamino)-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCCNC(=O)Nc1nc2ccc(C(=O)Nc3c(C)cc(C)cc3C)cc2s1 |
| InChI | InChI=1S/C22H26N4O2S/c1-5-6-9-23-21(28)26-22-24-17-8-7-16(12-18(17)29-22)20(27)25-19-14(3)10-13(2)11-15(19)4/h7-8,10-12H,5-6,9H2,1-4H3,(H,25,27)(H2,23,24,26,28) |
| InChIKey | HBPMXCDREHTURR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|