C13H8ClF3O3 — CID 22638948
6-chloro-7-ethynyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 22638948) has the molecular formula C13H8ClF3O3 and a molecular weight of 304.65 g/mol. Its IUPAC name is 6-chloro-7-ethynyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-ethynyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 22638948 |
| Molecular Formula | C13H8ClF3O3 |
| Molecular Weight | 304.65 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 6-chloro-7-ethynyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | C#Cc1cc2c(cc1Cl)CC(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H8ClF3O3/c1-2-6-5-10-7(4-9(6)14)3-8(12(18)19)11(20-10)13(15,16)17/h1,4-5,8,11H,3H2,(H,18,19) |
| InChIKey | JYGDTIAPCZPSFY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|