About benzhydryloxyphosphane
benzhydryloxyphosphane (PubChem CID 22639277) has the molecular formula C13H13OP
and a molecular weight of 216.22 g/mol. Its IUPAC name is benzhydryloxyphosphane.
Molecular Properties
| Compound Name | benzhydryloxyphosphane |
| PubChem CID | 22639277 |
| Molecular Formula | C13H13OP |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | benzhydryloxyphosphane |
| SMILES | POC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13OP/c15-14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,15H2 |
| InChIKey | OVSFXKCTADOYFM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzhydryloxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryloxyphosphane?
The IUPAC name of benzhydryloxyphosphane (CID 22639277) is benzhydryloxyphosphane.
What is the SMILES notation for benzhydryloxyphosphane?
The canonical SMILES for benzhydryloxyphosphane is POC(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydryloxyphosphane?
The InChIKey is OVSFXKCTADOYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13OP/c15-14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,15H2.
What are the key properties of benzhydryloxyphosphane?
benzhydryloxyphosphane has a molecular weight of 216.22 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryloxyphosphane is sourced from PubChem (CID 22639277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).