About 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene
2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene (PubChem CID 117071500) has the molecular formula C16H18O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene |
| PubChem CID | 117071500 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene |
| SMILES | COC(c1ccccc1)c1c(C)cccc1C |
| InChI | InChI=1S/C16H18O/c1-12-8-7-9-13(2)15(12)16(17-3)14-10-5-4-6-11-14/h4-11,16H,1-3H3 |
| InChIKey | QDPAMMQFRJSFBV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene?
The IUPAC name of 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene (CID 117071500) is 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene?
The canonical SMILES for 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene is COC(c1ccccc1)c1c(C)cccc1C.
What is the InChIKey of 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene?
The InChIKey is QDPAMMQFRJSFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O/c1-12-8-7-9-13(2)15(12)16(17-3)14-10-5-4-6-11-14/h4-11,16H,1-3H3.
What are the key properties of 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene?
2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene has a molecular weight of 226.32 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methoxy(phenyl)methyl]-1,3-dimethylbenzene is sourced from PubChem (CID 117071500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).