About [Bis(2,6-dimethylphenyl)methoxy]silane
[Bis(2,6-dimethylphenyl)methoxy]silane (PubChem CID 78067274) has the molecular formula C17H19OSi
and a molecular weight of 267.42 g/mol.
Molecular Properties
| Compound Name | [Bis(2,6-dimethylphenyl)methoxy]silane |
| PubChem CID | 78067274 |
| Molecular Formula | C17H19OSi |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1C(O[Si])c1c(C)cccc1C |
| InChI | InChI=1S/C17H19OSi/c1-11-7-5-8-12(2)15(11)17(18-19)16-13(3)9-6-10-14(16)4/h5-10,17H,1-4H3 |
| InChIKey | XRQKIYNRBKZZCP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [Bis(2,6-dimethylphenyl)methoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [Bis(2,6-dimethylphenyl)methoxy]silane?
The IUPAC name of [Bis(2,6-dimethylphenyl)methoxy]silane (CID 78067274) is not available.
What is the SMILES notation for [Bis(2,6-dimethylphenyl)methoxy]silane?
The canonical SMILES for [Bis(2,6-dimethylphenyl)methoxy]silane is Cc1cccc(C)c1C(O[Si])c1c(C)cccc1C.
What is the InChIKey of [Bis(2,6-dimethylphenyl)methoxy]silane?
The InChIKey is XRQKIYNRBKZZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19OSi/c1-11-7-5-8-12(2)15(11)17(18-19)16-13(3)9-6-10-14(16)4/h5-10,17H,1-4H3.
What are the key properties of [Bis(2,6-dimethylphenyl)methoxy]silane?
[Bis(2,6-dimethylphenyl)methoxy]silane has a molecular weight of 267.42 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [Bis(2,6-dimethylphenyl)methoxy]silane is sourced from PubChem (CID 78067274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).