C17H19OSi — CID 78067274
[Bis(2,6-dimethylphenyl)methoxy]silane (PubChem CID 78067274) has the molecular formula C17H19OSi and a molecular weight of 267.42 g/mol.
| Compound Name | [Bis(2,6-dimethylphenyl)methoxy]silane |
|---|---|
| PubChem CID | 78067274 |
| Molecular Formula | C17H19OSi |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1C(O[Si])c1c(C)cccc1C |
| InChI | InChI=1S/C17H19OSi/c1-11-7-5-8-12(2)15(11)17(18-19)16-13(3)9-6-10-14(16)4/h5-10,17H,1-4H3 |
| InChIKey | XRQKIYNRBKZZCP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|