C26H30ClN3O3 — CID 22641379
4-[[4-[3-(3-methoxypropoxy)pyrrolidin-1-yl]-2-methylquinolin-7-yl]oxymethyl]benzonitrile;hydrochloride (PubChem CID 22641379) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 4-[[4-[3-(3-methoxypropoxy)pyrrolidin-1-yl]-2-methylquinolin-7-yl]oxymethyl]benzonitrile;hydrochloride.
| Compound Name | 4-[[4-[3-(3-methoxypropoxy)pyrrolidin-1-yl]-2-methylquinolin-7-yl]oxymethyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 22641379 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-[[4-[3-(3-methoxypropoxy)pyrrolidin-1-yl]-2-methylquinolin-7-yl]oxymethyl]benzonitrile;hydrochloride |
| SMILES | COCCCOC1CCN(c2cc(C)nc3cc(OCc4ccc(C#N)cc4)ccc23)C1.Cl |
| InChI | InChI=1S/C26H29N3O3.ClH/c1-19-14-26(29-11-10-23(17-29)31-13-3-12-30-2)24-9-8-22(15-25(24)28-19)32-18-21-6-4-20(16-27)5-7-21;/h4-9,14-15,23H,3,10-13,17-18H2,1-2H3;1H |
| InChIKey | NTNFWJNKANIMTE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|