C18H20FIN2O2 — CID 22641884
2-[2-[5-[(4-fluorophenyl)methoxy]-2-iodophenyl]ethylamino]propanamide (PubChem CID 22641884) has the molecular formula C18H20FIN2O2 and a molecular weight of 442.27 g/mol. Its IUPAC name is 2-[2-[5-[(4-fluorophenyl)methoxy]-2-iodophenyl]ethylamino]propanamide.
| Compound Name | 2-[2-[5-[(4-fluorophenyl)methoxy]-2-iodophenyl]ethylamino]propanamide |
|---|---|
| PubChem CID | 22641884 |
| Molecular Formula | C18H20FIN2O2 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[2-[5-[(4-fluorophenyl)methoxy]-2-iodophenyl]ethylamino]propanamide |
| SMILES | CC(NCCc1cc(OCc2ccc(F)cc2)ccc1I)C(N)=O |
| InChI | InChI=1S/C18H20FIN2O2/c1-12(18(21)23)22-9-8-14-10-16(6-7-17(14)20)24-11-13-2-4-15(19)5-3-13/h2-7,10,12,22H,8-9,11H2,1H3,(H2,21,23) |
| InChIKey | FUENSYCDLQWMAP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|