C20H24INO3 — CID 59688144
(2S)-2-[ethyl(methyl)amino]-4-(2-iodo-5-phenylmethoxyphenyl)butanoic acid (PubChem CID 59688144) has the molecular formula C20H24INO3 and a molecular weight of 453.32 g/mol. Its IUPAC name is (2S)-2-[ethyl(methyl)amino]-4-(2-iodo-5-phenylmethoxyphenyl)butanoic acid.
| Compound Name | (2S)-2-[ethyl(methyl)amino]-4-(2-iodo-5-phenylmethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 59688144 |
| Molecular Formula | C20H24INO3 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (2S)-2-[ethyl(methyl)amino]-4-(2-iodo-5-phenylmethoxyphenyl)butanoic acid |
| SMILES | CCN(C)[C@@H](CCc1cc(OCc2ccccc2)ccc1I)C(=O)O |
| InChI | InChI=1S/C20H24INO3/c1-3-22(2)19(20(23)24)12-9-16-13-17(10-11-18(16)21)25-14-15-7-5-4-6-8-15/h4-8,10-11,13,19H,3,9,12,14H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | PYJFEDXIBZVQDD-IBGZPJMESA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|