C30H36N2OS — CID 22643457
N-(1-benzylpiperidin-4-yl)-3-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]propanethioamide (PubChem CID 22643457) has the molecular formula C30H36N2OS and a molecular weight of 472.70 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]propanethioamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]propanethioamide |
|---|---|
| PubChem CID | 22643457 |
| Molecular Formula | C30H36N2OS |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]propanethioamide |
| SMILES | COc1ccc(CCC(=S)N(Cc2ccc(C)cc2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H36N2OS/c1-24-8-10-27(11-9-24)23-32(30(34)17-14-25-12-15-29(33-2)16-13-25)28-18-20-31(21-19-28)22-26-6-4-3-5-7-26/h3-13,15-16,28H,14,17-23H2,1-2H3 |
| InChIKey | GWDQTMNKAISCFB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|