C26H29FN2O4S2 — CID 22643953
2-[4-[3-(2-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(2-thiophen-2-ylsulfanylethyl)piperidin-3-yl]acetic acid (PubChem CID 22643953) has the molecular formula C26H29FN2O4S2 and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-[4-[3-(2-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(2-thiophen-2-ylsulfanylethyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(2-thiophen-2-ylsulfanylethyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 22643953 |
| Molecular Formula | C26H29FN2O4S2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-[4-[3-(2-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(2-thiophen-2-ylsulfanylethyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nc(F)cc(C(=O)CCC3CCN(CCSc4cccs4)CC3CC(=O)O)c2c1 |
| InChI | InChI=1S/C26H29FN2O4S2/c1-33-19-5-6-22-20(14-19)21(15-24(27)28-22)23(30)7-4-17-8-9-29(16-18(17)13-25(31)32)10-12-35-26-3-2-11-34-26/h2-3,5-6,11,14-15,17-18H,4,7-10,12-13,16H2,1H3,(H,31,32) |
| InChIKey | YMGKNRYAZWKDTG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|