C20H17ClN4O5 — CID 22647655
ethyl 2-[2-chloro-4-(quinoxaline-6-carbonylcarbamoylamino)phenoxy]acetate (PubChem CID 22647655) has the molecular formula C20H17ClN4O5 and a molecular weight of 428.83 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(quinoxaline-6-carbonylcarbamoylamino)phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-(quinoxaline-6-carbonylcarbamoylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 22647655 |
| Molecular Formula | C20H17ClN4O5 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | ethyl 2-[2-chloro-4-(quinoxaline-6-carbonylcarbamoylamino)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)NC(=O)c2ccc3nccnc3c2)cc1Cl |
| InChI | InChI=1S/C20H17ClN4O5/c1-2-29-18(26)11-30-17-6-4-13(10-14(17)21)24-20(28)25-19(27)12-3-5-15-16(9-12)23-8-7-22-15/h3-10H,2,11H2,1H3,(H2,24,25,27,28) |
| InChIKey | GUYQJERYFXDNRD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |