C10H9BrN2OS — CID 2265052
2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 2265052) has the molecular formula C10H9BrN2OS and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2265052 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)CS/C1=N\c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrN2OS/c1-13-9(14)6-15-10(13)12-8-4-2-7(11)3-5-8/h2-5H,6H2,1H3/b12-10- |
| InChIKey | KAANEANCBKKQLE-BENRWUELSA-N |
| XLogP | 2.64 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|