C18H35N7O6 — CID 22650639
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-methylpentanoic acid (PubChem CID 22650639) has the molecular formula C18H35N7O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22650639 |
| Molecular Formula | C18H35N7O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CNC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)O)C(=O)O |
| InChI | InChI=1S/C18H35N7O6/c1-4-9(2)13(17(30)31)24-12(27)8-23-16(29)14(10(3)26)25-15(28)11(19)6-5-7-22-18(20)21/h9-11,13-14,26H,4-8,19H2,1-3H3,(H,23,29)(H,24,27)(H,25,28)(H,30,31)(H4,20,21,22) |
| InChIKey | FNNSFECRESEBGY-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|