C25H36N8O6 — CID 22651199
1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22651199) has the molecular formula C25H36N8O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22651199 |
| Molecular Formula | C25H36N8O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C25H36N8O6/c26-16(6-3-9-29-25(27)28)21(35)31-18(11-14-12-30-17-7-2-1-5-15(14)17)22(36)32-19(13-34)23(37)33-10-4-8-20(33)24(38)39/h1-2,5,7,12,16,18-20,30,34H,3-4,6,8-11,13,26H2,(H,31,35)(H,32,36)(H,38,39)(H4,27,28,29) |
| InChIKey | PEJFKMFZMVKPKQ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 242.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|