C33H41N9O5 — CID 22651182
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22651182) has the molecular formula C33H41N9O5 and a molecular weight of 643.75 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22651182 |
| Molecular Formula | C33H41N9O5 |
| Molecular Weight | 643.75 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)N1CCCC1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C33H41N9O5/c34-23(9-5-13-37-33(35)36)29(43)40-26(15-19-17-38-24-10-3-1-7-21(19)24)31(45)42-14-6-12-28(42)30(44)41-27(32(46)47)16-20-18-39-25-11-4-2-8-22(20)25/h1-4,7-8,10-11,17-18,23,26-28,38-39H,5-6,9,12-16,34H2,(H,40,43)(H,41,44)(H,46,47)(H4,35,36,37) |
| InChIKey | MQTZCNWCIUARKO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 237.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.75 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|