C27H40N8O5S — CID 19942741
2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 19942741) has the molecular formula C27H40N8O5S and a molecular weight of 588.74 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 19942741 |
| Molecular Formula | C27H40N8O5S |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H40N8O5S/c1-41-13-10-21(26(39)40)34-24(37)22-9-5-12-35(22)25(38)20(8-4-11-31-27(29)30)33-23(36)18(28)14-16-15-32-19-7-3-2-6-17(16)19/h2-3,6-7,15,18,20-22,32H,4-5,8-14,28H2,1H3,(H,33,36)(H,34,37)(H,39,40)(H4,29,30,31) |
| InChIKey | BNOFKPVKEAASLN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 222.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|