C27H40N8O5 — CID 19949902
2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19949902) has the molecular formula C27H40N8O5 and a molecular weight of 556.67 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19949902 |
| Molecular Formula | C27H40N8O5 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H40N8O5/c1-15(2)22(34-23(36)18(28)13-16-14-32-19-8-4-3-7-17(16)19)25(38)35-12-6-10-21(35)24(37)33-20(26(39)40)9-5-11-31-27(29)30/h3-4,7-8,14-15,18,20-22,32H,5-6,9-13,28H2,1-2H3,(H,33,37)(H,34,36)(H,39,40)(H4,29,30,31) |
| InChIKey | LHKKDIAPMPETCA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 222.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|