C26H36N8O7 — CID 19947646
2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 19947646) has the molecular formula C26H36N8O7 and a molecular weight of 572.62 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19947646 |
| Molecular Formula | C26H36N8O7 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H36N8O7/c27-16(11-14-13-31-17-6-2-1-5-15(14)17)24(39)34-10-4-8-20(34)23(38)32-18(7-3-9-30-26(28)29)22(37)33-19(25(40)41)12-21(35)36/h1-2,5-6,13,16,18-20,31H,3-4,7-12,27H2,(H,32,38)(H,33,37)(H,35,36)(H,40,41)(H4,28,29,30) |
| InChIKey | MRVMBVNXIGLQMS-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 259.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|