C25H36N8O5S — CID 19947647
2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19947647) has the molecular formula C25H36N8O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19947647 |
| Molecular Formula | C25H36N8O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-[[2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C25H36N8O5S/c26-16(11-14-12-30-17-6-2-1-5-15(14)17)23(36)33-10-4-8-20(33)22(35)31-18(7-3-9-29-25(27)28)21(34)32-19(13-39)24(37)38/h1-2,5-6,12,16,18-20,30,39H,3-4,7-11,13,26H2,(H,31,35)(H,32,34)(H,37,38)(H4,27,28,29) |
| InChIKey | LHPLJDAXTLFXLE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 222.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|