C26H38N8O6 — CID 18751025
2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18751025) has the molecular formula C26H38N8O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18751025 |
| Molecular Formula | C26H38N8O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)N1CCCC1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H38N8O6/c1-14(35)21(27)24(38)34-11-5-9-20(34)23(37)33-19(12-15-13-31-17-7-3-2-6-16(15)17)22(36)32-18(25(39)40)8-4-10-30-26(28)29/h2-3,6-7,13-14,18-21,31,35H,4-5,8-12,27H2,1H3,(H,32,36)(H,33,37)(H,39,40)(H4,28,29,30) |
| InChIKey | RUMMSAIRFQEEFT-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 242.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|