C24H36N8O3 — CID 175775622
(2S)-1-[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide (PubChem CID 175775622) has the molecular formula C24H36N8O3 and a molecular weight of 484.61 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175775622 |
| Molecular Formula | C24H36N8O3 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H36N8O3/c1-2-28-22(34)20-10-6-12-32(20)23(35)19(9-5-11-29-24(26)27)31-21(33)17(25)13-15-14-30-18-8-4-3-7-16(15)18/h3-4,7-8,14,17,19-20,30H,2,5-6,9-13,25H2,1H3,(H,28,34)(H,31,33)(H4,26,27,29)/t17-,19-,20-/m0/s1 |
| InChIKey | DUVOHQVFPVLYDR-IHPCNDPISA-N |
| XLogP | -0.30 |
| TPSA | 184.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|