C28H42N8O5 — CID 18246268
2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18246268) has the molecular formula C28H42N8O5 and a molecular weight of 570.70 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18246268 |
| Molecular Formula | C28H42N8O5 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H42N8O5/c1-3-16(2)23(25(38)34-21(27(40)41)14-17-15-33-20-10-5-4-8-18(17)20)35-24(37)22-11-7-13-36(22)26(39)19(29)9-6-12-32-28(30)31/h4-5,8,10,15-16,19,21-23,33H,3,6-7,9,11-14,29H2,1-2H3,(H,34,38)(H,35,37)(H,40,41)(H4,30,31,32) |
| InChIKey | SZRYHKLOJPIPSY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 222.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|