C19H32N8O8 — CID 22653556
2-[[1-[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22653556) has the molecular formula C19H32N8O8 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-[[1-[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22653556 |
| Molecular Formula | C19H32N8O8 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[[1-[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CC(=O)O)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H32N8O8/c20-9(7-13(21)28)15(31)26-11(8-14(29)30)17(33)27-6-2-4-12(27)16(32)25-10(18(34)35)3-1-5-24-19(22)23/h9-12H,1-8,20H2,(H2,21,28)(H,25,32)(H,26,31)(H,29,30)(H,34,35)(H4,22,23,24) |
| InChIKey | BEWVQKOKJIAHAX-UHFFFAOYSA-N |
| XLogP | -4.24 |
| TPSA | 286.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|