C8H6F10O3S — CID 22660509
1-ethyl-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-sulfonic acid (PubChem CID 22660509) has the molecular formula C8H6F10O3S and a molecular weight of 372.18 g/mol. Its IUPAC name is 1-ethyl-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-sulfonic acid.
| Compound Name | 1-ethyl-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 22660509 |
| Molecular Formula | C8H6F10O3S |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-ethyl-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-sulfonic acid |
| SMILES | CCC1(S(=O)(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H6F10O3S/c1-2-3(22(19,20)21)4(9,10)6(13,14)8(17,18)7(15,16)5(3,11)12/h2H2,1H3,(H,19,20,21) |
| InChIKey | JUFLSDAQPQUAMY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|