C11H11NO4S2 — CID 22662727
2-[1-benzothiophen-3-ylsulfonyl(methyl)amino]acetic acid (PubChem CID 22662727) has the molecular formula C11H11NO4S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-ylsulfonyl(methyl)amino]acetic acid.
| Compound Name | 2-[1-benzothiophen-3-ylsulfonyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 22662727 |
| Molecular Formula | C11H11NO4S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-[1-benzothiophen-3-ylsulfonyl(methyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C11H11NO4S2/c1-12(6-11(13)14)18(15,16)10-7-17-9-5-3-2-4-8(9)10/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | XUJLSXLMZNREFE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |