C24H23N5O3 — CID 22663120
1-[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]-3-phenylurea (PubChem CID 22663120) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 22663120 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]-3-phenylurea |
| SMILES | CNc1nc(-c2cccc(NC(=O)Nc3ccccc3)c2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C24H23N5O3/c1-25-23-28-19-14-21(32-3)20(31-2)13-18(19)22(29-23)15-8-7-11-17(12-15)27-24(30)26-16-9-5-4-6-10-16/h4-14H,1-3H3,(H,25,28,29)(H2,26,27,30) |
| InChIKey | GRJOYOLBRHAVNJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |