C11H13BrN2O — CID 22663369
N-(5-bromo-2-methoxyphenyl)-N'-cyclopropylmethanimidamide (PubChem CID 22663369) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-N'-cyclopropylmethanimidamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-N'-cyclopropylmethanimidamide |
|---|---|
| PubChem CID | 22663369 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-N'-cyclopropylmethanimidamide |
| SMILES | COc1ccc(Br)cc1N/C=N/C1CC1 |
| InChI | InChI=1S/C11H13BrN2O/c1-15-11-5-2-8(12)6-10(11)14-7-13-9-3-4-9/h2,5-7,9H,3-4H2,1H3,(H,13,14) |
| InChIKey | VHXCZNGKSFBZAT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|