C23H17N3O5S — CID 2266791
(5Z)-3-[2-(4-methylphenyl)-2-oxoethyl]-5-[[1-(3-nitrophenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2266791) has the molecular formula C23H17N3O5S and a molecular weight of 447.47 g/mol. Its IUPAC name is (5Z)-3-[2-(4-methylphenyl)-2-oxoethyl]-5-[[1-(3-nitrophenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-methylphenyl)-2-oxoethyl]-5-[[1-(3-nitrophenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2266791 |
| Molecular Formula | C23H17N3O5S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (5Z)-3-[2-(4-methylphenyl)-2-oxoethyl]-5-[[1-(3-nitrophenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)CN2C(=O)S/C(=C\c3cccn3-c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O5S/c1-15-7-9-16(10-8-15)20(27)14-25-22(28)21(32-23(25)29)13-18-6-3-11-24(18)17-4-2-5-19(12-17)26(30)31/h2-13H,14H2,1H3/b21-13- |
| InChIKey | RDBYYTYUHIGLGP-BKUYFWCQSA-N |
| XLogP | 4.61 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|