C19H22N2O — CID 22669700
3,5-dimethyl-4-[(3-propan-2-yl-1H-indol-5-yl)oxy]aniline (PubChem CID 22669700) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(3-propan-2-yl-1H-indol-5-yl)oxy]aniline.
| Compound Name | 3,5-dimethyl-4-[(3-propan-2-yl-1H-indol-5-yl)oxy]aniline |
|---|---|
| PubChem CID | 22669700 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3,5-dimethyl-4-[(3-propan-2-yl-1H-indol-5-yl)oxy]aniline |
| SMILES | Cc1cc(N)cc(C)c1Oc1ccc2[nH]cc(C(C)C)c2c1 |
| InChI | InChI=1S/C19H22N2O/c1-11(2)17-10-21-18-6-5-15(9-16(17)18)22-19-12(3)7-14(20)8-13(19)4/h5-11,21H,20H2,1-4H3 |
| InChIKey | XUPRWRWLSJDBSL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|