C16H17O7P — CID 22673522
[4-hydroxy-2-[4-(4-hydroxyphenyl)butanoyl]phenyl] dihydrogen phosphate (PubChem CID 22673522) has the molecular formula C16H17O7P and a molecular weight of 352.28 g/mol. Its IUPAC name is [4-hydroxy-2-[4-(4-hydroxyphenyl)butanoyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-hydroxy-2-[4-(4-hydroxyphenyl)butanoyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22673522 |
| Molecular Formula | C16H17O7P |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [4-hydroxy-2-[4-(4-hydroxyphenyl)butanoyl]phenyl] dihydrogen phosphate |
| SMILES | O=C(CCCc1ccc(O)cc1)c1cc(O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C16H17O7P/c17-12-6-4-11(5-7-12)2-1-3-15(19)14-10-13(18)8-9-16(14)23-24(20,21)22/h4-10,17-18H,1-3H2,(H2,20,21,22) |
| InChIKey | DEQSLGZMFCGFBZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|