C14H14NO6P — CID 22673791
[[6-[2-(4-hydroxyphenyl)acetyl]-3-oxocyclohexa-1,4-dien-1-yl]amino]phosphonic acid (PubChem CID 22673791) has the molecular formula C14H14NO6P and a molecular weight of 323.24 g/mol. Its IUPAC name is [[6-[2-(4-hydroxyphenyl)acetyl]-3-oxocyclohexa-1,4-dien-1-yl]amino]phosphonic acid.
| Compound Name | [[6-[2-(4-hydroxyphenyl)acetyl]-3-oxocyclohexa-1,4-dien-1-yl]amino]phosphonic acid |
|---|---|
| PubChem CID | 22673791 |
| Molecular Formula | C14H14NO6P |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [[6-[2-(4-hydroxyphenyl)acetyl]-3-oxocyclohexa-1,4-dien-1-yl]amino]phosphonic acid |
| SMILES | O=C1C=CC(C(=O)Cc2ccc(O)cc2)C(NP(=O)(O)O)=C1 |
| InChI | InChI=1S/C14H14NO6P/c16-10-3-1-9(2-4-10)7-14(18)12-6-5-11(17)8-13(12)15-22(19,20)21/h1-6,8,12,16H,7H2,(H3,15,19,20,21) |
| InChIKey | JOIJVEOIYKVCRK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|