C26H30Cl2N6O — CID 22674772
3-benzhydryl-1-[[2-methoxy-5-(tetrazol-1-yl)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 22674772) has the molecular formula C26H30Cl2N6O and a molecular weight of 513.47 g/mol. Its IUPAC name is 3-benzhydryl-1-[[2-methoxy-5-(tetrazol-1-yl)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 3-benzhydryl-1-[[2-methoxy-5-(tetrazol-1-yl)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 22674772 |
| Molecular Formula | C26H30Cl2N6O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-benzhydryl-1-[[2-methoxy-5-(tetrazol-1-yl)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(-n2cnnn2)cc1CN1CCNC(C(c2ccccc2)c2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C26H28N6O.2ClH/c1-33-25-13-12-23(32-19-28-29-30-32)16-22(25)17-31-15-14-27-24(18-31)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21;;/h2-13,16,19,24,26-27H,14-15,17-18H2,1H3;2*1H |
| InChIKey | XDDOXHDLWQRZNT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |