C23H32N2O2 — CID 67633791
3-[1-(3,4-dimethoxyphenyl)ethyl]-1-(3-phenylpropyl)piperazine (PubChem CID 67633791) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-[1-(3,4-dimethoxyphenyl)ethyl]-1-(3-phenylpropyl)piperazine.
| Compound Name | 3-[1-(3,4-dimethoxyphenyl)ethyl]-1-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 67633791 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-[1-(3,4-dimethoxyphenyl)ethyl]-1-(3-phenylpropyl)piperazine |
| SMILES | COc1ccc(C(C)C2CN(CCCc3ccccc3)CCN2)cc1OC |
| InChI | InChI=1S/C23H32N2O2/c1-18(20-11-12-22(26-2)23(16-20)27-3)21-17-25(15-13-24-21)14-7-10-19-8-5-4-6-9-19/h4-6,8-9,11-12,16,18,21,24H,7,10,13-15,17H2,1-3H3 |
| InChIKey | REYONDXDXDVBGK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |