C21H28N2O2 — CID 113223845
1-benzyl-N-[1-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-amine (PubChem CID 113223845) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-benzyl-N-[1-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-[1-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 113223845 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-benzyl-N-[1-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-amine |
| SMILES | COc1ccc(C(C)NC2CCN(Cc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C21H28N2O2/c1-16(18-9-10-20(24-2)21(13-18)25-3)22-19-11-12-23(15-19)14-17-7-5-4-6-8-17/h4-10,13,16,19,22H,11-12,14-15H2,1-3H3 |
| InChIKey | AUEHYSQBRJFNSO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |