C21H25F3N2O — CID 67407391
N-[1-(3-methoxyphenyl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 67407391) has the molecular formula C21H25F3N2O and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | N-[1-(3-methoxyphenyl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 67407391 |
| Molecular Formula | C21H25F3N2O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[1-(3-methoxyphenyl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | COc1cccc(C(C)NC2CCN(Cc3cccc(C(F)(F)F)c3)C2)c1 |
| InChI | InChI=1S/C21H25F3N2O/c1-15(17-6-4-8-20(12-17)27-2)25-19-9-10-26(14-19)13-16-5-3-7-18(11-16)21(22,23)24/h3-8,11-12,15,19,25H,9-10,13-14H2,1-2H3 |
| InChIKey | OMFDFILSCXTIAX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |