C26H28F3N3 — CID 139982347
N-[(2-aminophenyl)-phenylmethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 139982347) has the molecular formula C26H28F3N3 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[(2-aminophenyl)-phenylmethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-[(2-aminophenyl)-phenylmethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 139982347 |
| Molecular Formula | C26H28F3N3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[(2-aminophenyl)-phenylmethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | Nc1ccccc1C(NC1CCN(Cc2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H28F3N3/c27-26(28,29)21-10-6-7-19(17-21)18-32-15-13-22(14-16-32)31-25(20-8-2-1-3-9-20)23-11-4-5-12-24(23)30/h1-12,17,22,25,31H,13-16,18,30H2 |
| InChIKey | CSPSUTDTBICIIF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|