C20H24F3NO — CID 20642616
(2S)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]butan-2-amine (PubChem CID 20642616) has the molecular formula C20H24F3NO and a molecular weight of 351.41 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]butan-2-amine.
| Compound Name | (2S)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 20642616 |
| Molecular Formula | C20H24F3NO |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]butan-2-amine |
| SMILES | COc1cccc([C@@H](C)N[C@@H](C)CCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H24F3NO/c1-14(24-15(2)17-7-5-9-19(13-17)25-3)10-11-16-6-4-8-18(12-16)20(21,22)23/h4-9,12-15,24H,10-11H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | WUJGBMFLRSAJBI-LSDHHAIUSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |