C16H17F3NOP — CID 176995369
1-(3-methoxyphenyl)-1-phosphanyl-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine (PubChem CID 176995369) has the molecular formula C16H17F3NOP and a molecular weight of 327.29 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-1-phosphanyl-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine.
| Compound Name | 1-(3-methoxyphenyl)-1-phosphanyl-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 176995369 |
| Molecular Formula | C16H17F3NOP |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-1-phosphanyl-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine |
| SMILES | COc1cccc(C(P)NCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H17F3NOP/c1-21-14-7-3-5-12(9-14)15(22)20-10-11-4-2-6-13(8-11)16(17,18)19/h2-9,15,20H,10,22H2,1H3 |
| InChIKey | RVQSPGGIQQRATC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|