C17H23ClNOP — CID 176995318
N-[(4-chlorophenyl)methyl]-1-(3-methoxyphenyl)-1-phosphanylmethanamine;ethane (PubChem CID 176995318) has the molecular formula C17H23ClNOP and a molecular weight of 323.80 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-(3-methoxyphenyl)-1-phosphanylmethanamine;ethane.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-(3-methoxyphenyl)-1-phosphanylmethanamine;ethane |
|---|---|
| PubChem CID | 176995318 |
| Molecular Formula | C17H23ClNOP |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-(3-methoxyphenyl)-1-phosphanylmethanamine;ethane |
| SMILES | CC.COc1cccc(C(P)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H17ClNOP.C2H6/c1-18-14-4-2-3-12(9-14)15(19)17-10-11-5-7-13(16)8-6-11;1-2/h2-9,15,17H,10,19H2,1H3;1-2H3 |
| InChIKey | LLUOZMCHNOETKF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|